About CID 177047265
CID 177047265 (PubChem CID 177047265) has the molecular formula C8H5BN2
and a molecular weight of 139.95 g/mol.
Molecular Properties
| Compound Name | CID 177047265 |
| PubChem CID | 177047265 |
| Molecular Formula | C8H5BN2 |
| Molecular Weight | 139.95 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2cccnc2n1 |
| InChI | InChI=1S/C8H5BN2/c9-7-4-3-6-2-1-5-10-8(6)11-7/h1-5H |
| InChIKey | LRGZHDKJORVPET-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.95 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177047265 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177047265?
The IUPAC name of CID 177047265 (CID 177047265) is not available.
What is the SMILES notation for CID 177047265?
The canonical SMILES for CID 177047265 is [B]c1ccc2cccnc2n1.
What is the InChIKey of CID 177047265?
The InChIKey is LRGZHDKJORVPET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BN2/c9-7-4-3-6-2-1-5-10-8(6)11-7/h1-5H.
What are the key properties of CID 177047265?
CID 177047265 has a molecular weight of 139.95 g/mol, XLogP of 0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177047265 is sourced from PubChem (CID 177047265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).