C12H16N4 — CID 157389388
1,8-naphthyridine;piperazine (PubChem CID 157389388) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 1,8-naphthyridine;piperazine.
| Compound Name | 1,8-naphthyridine;piperazine |
|---|---|
| PubChem CID | 157389388 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 1,8-naphthyridine;piperazine |
| SMILES | C1CNCCN1.c1cnc2ncccc2c1 |
| InChI | InChI=1S/C8H6N2.C4H10N2/c1-3-7-4-2-6-10-8(7)9-5-1;1-2-6-4-3-5-1/h1-6H;5-6H,1-4H2 |
| InChIKey | BLUYRKLMZWUPQO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |