C12H12BrN5 — CID 175472376
1,8-naphthyridin-2-amine;pyrimidine;hydrobromide (PubChem CID 175472376) has the molecular formula C12H12BrN5 and a molecular weight of 306.17 g/mol. Its IUPAC name is 1,8-naphthyridin-2-amine;pyrimidine;hydrobromide.
| Compound Name | 1,8-naphthyridin-2-amine;pyrimidine;hydrobromide |
|---|---|
| PubChem CID | 175472376 |
| Molecular Formula | C12H12BrN5 |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 1,8-naphthyridin-2-amine;pyrimidine;hydrobromide |
| SMILES | Br.Nc1ccc2cccnc2n1.c1cncnc1 |
| InChI | InChI=1S/C8H7N3.C4H4N2.BrH/c9-7-4-3-6-2-1-5-10-8(6)11-7;1-2-5-4-6-3-1;/h1-5H,(H2,9,10,11);1-4H;1H |
| InChIKey | OYEZDNNXSXBIPN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |