C10H10N4 — CID 172623123
N'-methyl-1,8-naphthyridine-2-carboximidamide (PubChem CID 172623123) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is N'-methyl-1,8-naphthyridine-2-carboximidamide.
| Compound Name | N'-methyl-1,8-naphthyridine-2-carboximidamide |
|---|---|
| PubChem CID | 172623123 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | N'-methyl-1,8-naphthyridine-2-carboximidamide |
| SMILES | C/N=C(\N)c1ccc2cccnc2n1 |
| InChI | InChI=1S/C10H10N4/c1-12-9(11)8-5-4-7-3-2-6-13-10(7)14-8/h2-6H,1H3,(H2,11,12) |
| InChIKey | BUSMNPPTLIZIAG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|