C13H13N3O — CID 177046765
N-cyclobutyl-1,8-naphthyridine-2-carboxamide (PubChem CID 177046765) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is N-cyclobutyl-1,8-naphthyridine-2-carboxamide.
| Compound Name | N-cyclobutyl-1,8-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 177046765 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-cyclobutyl-1,8-naphthyridine-2-carboxamide |
| SMILES | O=C(NC1CCC1)c1ccc2cccnc2n1 |
| InChI | InChI=1S/C13H13N3O/c17-13(15-10-4-1-5-10)11-7-6-9-3-2-8-14-12(9)16-11/h2-3,6-8,10H,1,4-5H2,(H,15,17) |
| InChIKey | QNNWUVYIOSESQN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |