C10H11ClN2O — CID 62416543
6-chloro-N-cyclobutylpyridine-2-carboxamide (PubChem CID 62416543) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is 6-chloro-N-cyclobutylpyridine-2-carboxamide.
| Compound Name | 6-chloro-N-cyclobutylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 62416543 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 6-chloro-N-cyclobutylpyridine-2-carboxamide |
| SMILES | O=C(NC1CCC1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C10H11ClN2O/c11-9-6-2-5-8(13-9)10(14)12-7-3-1-4-7/h2,5-7H,1,3-4H2,(H,12,14) |
| InChIKey | VUNYJVRSEPYBSZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|