C20H23N3O2 — CID 109095019
6-N-cyclopentyl-2-N-(2,6-dimethylphenyl)pyridine-2,6-dicarboxamide (PubChem CID 109095019) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 6-N-cyclopentyl-2-N-(2,6-dimethylphenyl)pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-cyclopentyl-2-N-(2,6-dimethylphenyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 109095019 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 6-N-cyclopentyl-2-N-(2,6-dimethylphenyl)pyridine-2,6-dicarboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cccc(C(=O)NC2CCCC2)n1 |
| InChI | InChI=1S/C20H23N3O2/c1-13-7-5-8-14(2)18(13)23-20(25)17-12-6-11-16(22-17)19(24)21-15-9-3-4-10-15/h5-8,11-12,15H,3-4,9-10H2,1-2H3,(H,21,24)(H,23,25) |
| InChIKey | FRCRBNKMJBJRHX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |