C9H5ClN2O — CID 129321879
1,8-naphthyridine-2-carbonyl chloride (PubChem CID 129321879) has the molecular formula C9H5ClN2O and a molecular weight of 192.61 g/mol. Its IUPAC name is 1,8-naphthyridine-2-carbonyl chloride.
| Compound Name | 1,8-naphthyridine-2-carbonyl chloride |
|---|---|
| PubChem CID | 129321879 |
| Molecular Formula | C9H5ClN2O |
| Molecular Weight | 192.61 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 1,8-naphthyridine-2-carbonyl chloride |
| SMILES | O=C(Cl)c1ccc2cccnc2n1 |
| InChI | InChI=1S/C9H5ClN2O/c10-8(13)7-4-3-6-2-1-5-11-9(6)12-7/h1-5H |
| InChIKey | JDPVTLXKRNPCDC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.61 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|