C16H12FN3O — CID 16728138
N-[(2-fluorophenyl)methyl]-1,8-naphthyridine-2-carboxamide (PubChem CID 16728138) has the molecular formula C16H12FN3O and a molecular weight of 281.29 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-1,8-naphthyridine-2-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-1,8-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 16728138 |
| Molecular Formula | C16H12FN3O |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-1,8-naphthyridine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1F)c1ccc2cccnc2n1 |
| InChI | InChI=1S/C16H12FN3O/c17-13-6-2-1-4-12(13)10-19-16(21)14-8-7-11-5-3-9-18-15(11)20-14/h1-9H,10H2,(H,19,21) |
| InChIKey | QEMKDZXVHKKVDL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |