C12H12FN5O — CID 62248326
N-[(2-fluorophenyl)methyl]-6-hydrazinylpyridazine-3-carboxamide (PubChem CID 62248326) has the molecular formula C12H12FN5O and a molecular weight of 261.26 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-6-hydrazinylpyridazine-3-carboxamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-6-hydrazinylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62248326 |
| Molecular Formula | C12H12FN5O |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-6-hydrazinylpyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)NCc2ccccc2F)nn1 |
| InChI | InChI=1S/C12H12FN5O/c13-9-4-2-1-3-8(9)7-15-12(19)10-5-6-11(16-14)18-17-10/h1-6H,7,14H2,(H,15,19)(H,16,18) |
| InChIKey | CCOJFIOGMSMCOC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|