C19H16ClFN4O — CID 109119292
6-[(4-chlorophenyl)methylamino]-N-[(2-fluorophenyl)methyl]pyridazine-3-carboxamide (PubChem CID 109119292) has the molecular formula C19H16ClFN4O and a molecular weight of 370.82 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methylamino]-N-[(2-fluorophenyl)methyl]pyridazine-3-carboxamide.
| Compound Name | 6-[(4-chlorophenyl)methylamino]-N-[(2-fluorophenyl)methyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109119292 |
| Molecular Formula | C19H16ClFN4O |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 6-[(4-chlorophenyl)methylamino]-N-[(2-fluorophenyl)methyl]pyridazine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1F)c1ccc(NCc2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C19H16ClFN4O/c20-15-7-5-13(6-8-15)11-22-18-10-9-17(24-25-18)19(26)23-12-14-3-1-2-4-16(14)21/h1-10H,11-12H2,(H,22,25)(H,23,26) |
| InChIKey | QPOKHWQBWBTGCK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |