C9H10N6O2 — CID 106423177
6-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)pyridazine-3-carboxamide (PubChem CID 106423177) has the molecular formula C9H10N6O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 6-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)pyridazine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 106423177 |
| Molecular Formula | C9H10N6O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 6-hydrazinyl-N-(1,2-oxazol-5-ylmethyl)pyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)NCc2ccno2)nn1 |
| InChI | InChI=1S/C9H10N6O2/c10-13-8-2-1-7(14-15-8)9(16)11-5-6-3-4-12-17-6/h1-4H,5,10H2,(H,11,16)(H,13,15) |
| InChIKey | ZKPFWVLRIDAPFX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|