C11H8N4O2 — CID 113355793
5-cyano-N-(1,2-oxazol-5-ylmethyl)pyridine-2-carboxamide (PubChem CID 113355793) has the molecular formula C11H8N4O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is 5-cyano-N-(1,2-oxazol-5-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 5-cyano-N-(1,2-oxazol-5-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 113355793 |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 5-cyano-N-(1,2-oxazol-5-ylmethyl)pyridine-2-carboxamide |
| SMILES | N#Cc1ccc(C(=O)NCc2ccno2)nc1 |
| InChI | InChI=1S/C11H8N4O2/c12-5-8-1-2-10(13-6-8)11(16)14-7-9-3-4-15-17-9/h1-4,6H,7H2,(H,14,16) |
| InChIKey | UGFVJVHZSUOSEM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |