C11H9N3O — CID 115866853
N-but-2-ynyl-5-cyanopyridine-2-carboxamide (PubChem CID 115866853) has the molecular formula C11H9N3O and a molecular weight of 199.21 g/mol. Its IUPAC name is N-but-2-ynyl-5-cyanopyridine-2-carboxamide.
| Compound Name | N-but-2-ynyl-5-cyanopyridine-2-carboxamide |
|---|---|
| PubChem CID | 115866853 |
| Molecular Formula | C11H9N3O |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | N-but-2-ynyl-5-cyanopyridine-2-carboxamide |
| SMILES | CC#CCNC(=O)c1ccc(C#N)cn1 |
| InChI | InChI=1S/C11H9N3O/c1-2-3-6-13-11(15)10-5-4-9(7-12)8-14-10/h4-5,8H,6H2,1H3,(H,13,15) |
| InChIKey | ZWVNMPSQQXRHTE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|