C9H10N4O3S — CID 63719383
5-cyano-N-(2-sulfamoylethyl)pyridine-2-carboxamide (PubChem CID 63719383) has the molecular formula C9H10N4O3S and a molecular weight of 254.27 g/mol. Its IUPAC name is 5-cyano-N-(2-sulfamoylethyl)pyridine-2-carboxamide.
| Compound Name | 5-cyano-N-(2-sulfamoylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63719383 |
| Molecular Formula | C9H10N4O3S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 5-cyano-N-(2-sulfamoylethyl)pyridine-2-carboxamide |
| SMILES | N#Cc1ccc(C(=O)NCCS(N)(=O)=O)nc1 |
| InChI | InChI=1S/C9H10N4O3S/c10-5-7-1-2-8(13-6-7)9(14)12-3-4-17(11,15)16/h1-2,6H,3-4H2,(H,12,14)(H2,11,15,16) |
| InChIKey | KEZJBCMUDNNDOO-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |