C7H11N5O3S — CID 107374558
5-amino-N-(2-sulfamoylethyl)pyrazine-2-carboxamide (PubChem CID 107374558) has the molecular formula C7H11N5O3S and a molecular weight of 245.26 g/mol. Its IUPAC name is 5-amino-N-(2-sulfamoylethyl)pyrazine-2-carboxamide.
| Compound Name | 5-amino-N-(2-sulfamoylethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107374558 |
| Molecular Formula | C7H11N5O3S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 5-amino-N-(2-sulfamoylethyl)pyrazine-2-carboxamide |
| SMILES | Nc1cnc(C(=O)NCCS(N)(=O)=O)cn1 |
| InChI | InChI=1S/C7H11N5O3S/c8-6-4-11-5(3-12-6)7(13)10-1-2-16(9,14)15/h3-4H,1-2H2,(H2,8,12)(H,10,13)(H2,9,14,15) |
| InChIKey | MOHGUVJYRLOTMG-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |