C10H17N5O3S — CID 62155667
5-amino-2-propan-2-yl-N-(2-sulfamoylethyl)pyrimidine-4-carboxamide (PubChem CID 62155667) has the molecular formula C10H17N5O3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-amino-2-propan-2-yl-N-(2-sulfamoylethyl)pyrimidine-4-carboxamide.
| Compound Name | 5-amino-2-propan-2-yl-N-(2-sulfamoylethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 62155667 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 5-amino-2-propan-2-yl-N-(2-sulfamoylethyl)pyrimidine-4-carboxamide |
| SMILES | CC(C)c1ncc(N)c(C(=O)NCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C10H17N5O3S/c1-6(2)9-14-5-7(11)8(15-9)10(16)13-3-4-19(12,17)18/h5-6H,3-4,11H2,1-2H3,(H,13,16)(H2,12,17,18) |
| InChIKey | GGXNEMRSVNXNHI-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |