C11H15F3N4OS — CID 106432982
5-amino-2-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4-carboxamide (PubChem CID 106432982) has the molecular formula C11H15F3N4OS and a molecular weight of 308.33 g/mol. Its IUPAC name is 5-amino-2-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4-carboxamide.
| Compound Name | 5-amino-2-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 106432982 |
| Molecular Formula | C11H15F3N4OS |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-amino-2-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidine-4-carboxamide |
| SMILES | CC(C)c1ncc(N)c(C(=O)NCCSC(F)(F)F)n1 |
| InChI | InChI=1S/C11H15F3N4OS/c1-6(2)9-17-5-7(15)8(18-9)10(19)16-3-4-20-11(12,13)14/h5-6H,3-4,15H2,1-2H3,(H,16,19) |
| InChIKey | PJUTYHRIJLUNKL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|