C12H21N5O3S — CID 62179987
5-(methylamino)-2-propan-2-yl-N-(3-sulfamoylpropyl)pyrimidine-4-carboxamide (PubChem CID 62179987) has the molecular formula C12H21N5O3S and a molecular weight of 315.40 g/mol. Its IUPAC name is 5-(methylamino)-2-propan-2-yl-N-(3-sulfamoylpropyl)pyrimidine-4-carboxamide.
| Compound Name | 5-(methylamino)-2-propan-2-yl-N-(3-sulfamoylpropyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 62179987 |
| Molecular Formula | C12H21N5O3S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 5-(methylamino)-2-propan-2-yl-N-(3-sulfamoylpropyl)pyrimidine-4-carboxamide |
| SMILES | CNc1cnc(C(C)C)nc1C(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C12H21N5O3S/c1-8(2)11-16-7-9(14-3)10(17-11)12(18)15-5-4-6-21(13,19)20/h7-8,14H,4-6H2,1-3H3,(H,15,18)(H2,13,19,20) |
| InChIKey | SNEQQRGNJOMFDE-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|