C5H8N4O3S2 — CID 65215862
N-(2-sulfamoylethyl)thiadiazole-4-carboxamide (PubChem CID 65215862) has the molecular formula C5H8N4O3S2 and a molecular weight of 236.28 g/mol. Its IUPAC name is N-(2-sulfamoylethyl)thiadiazole-4-carboxamide.
| Compound Name | N-(2-sulfamoylethyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65215862 |
| Molecular Formula | C5H8N4O3S2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | N-(2-sulfamoylethyl)thiadiazole-4-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1csnn1 |
| InChI | InChI=1S/C5H8N4O3S2/c6-14(11,12)2-1-7-5(10)4-3-13-9-8-4/h3H,1-2H2,(H,7,10)(H2,6,11,12) |
| InChIKey | RTWGXJAZXGSXKF-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |