C7H9ClN4O3S — CID 103187109
6-chloro-N-(2-sulfamoylethyl)pyrazine-2-carboxamide (PubChem CID 103187109) has the molecular formula C7H9ClN4O3S and a molecular weight of 264.69 g/mol. Its IUPAC name is 6-chloro-N-(2-sulfamoylethyl)pyrazine-2-carboxamide.
| Compound Name | 6-chloro-N-(2-sulfamoylethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 103187109 |
| Molecular Formula | C7H9ClN4O3S |
| Molecular Weight | 264.69 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 6-chloro-N-(2-sulfamoylethyl)pyrazine-2-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1cncc(Cl)n1 |
| InChI | InChI=1S/C7H9ClN4O3S/c8-6-4-10-3-5(12-6)7(13)11-1-2-16(9,14)15/h3-4H,1-2H2,(H,11,13)(H2,9,14,15) |
| InChIKey | NBHLIKXBMYLZTR-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.69 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |