C9H12ClN3O3S — CID 62234046
6-chloro-N-(3-sulfamoylpropyl)pyridine-2-carboxamide (PubChem CID 62234046) has the molecular formula C9H12ClN3O3S and a molecular weight of 277.73 g/mol. Its IUPAC name is 6-chloro-N-(3-sulfamoylpropyl)pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-(3-sulfamoylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62234046 |
| Molecular Formula | C9H12ClN3O3S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 6-chloro-N-(3-sulfamoylpropyl)pyridine-2-carboxamide |
| SMILES | NS(=O)(=O)CCCNC(=O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C9H12ClN3O3S/c10-8-4-1-3-7(13-8)9(14)12-5-2-6-17(11,15)16/h1,3-4H,2,5-6H2,(H,12,14)(H2,11,15,16) |
| InChIKey | KIYLRPJYUCAYGU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|