C10H12ClN3O2 — CID 62234709
N-(2-acetamidoethyl)-6-chloropyridine-2-carboxamide (PubChem CID 62234709) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-6-chloropyridine-2-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-6-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 62234709 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | N-(2-acetamidoethyl)-6-chloropyridine-2-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C10H12ClN3O2/c1-7(15)12-5-6-13-10(16)8-3-2-4-9(11)14-8/h2-4H,5-6H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | FZJCSDYNCHYPEA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|