C10H11Cl2N3O2 — CID 106993229
N-(2-acetamidoethyl)-2,6-dichloropyridine-3-carboxamide (PubChem CID 106993229) has the molecular formula C10H11Cl2N3O2 and a molecular weight of 276.12 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2,6-dichloropyridine-3-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-2,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 106993229 |
| Molecular Formula | C10H11Cl2N3O2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | N-(2-acetamidoethyl)-2,6-dichloropyridine-3-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O2/c1-6(16)13-4-5-14-10(17)7-2-3-8(11)15-9(7)12/h2-3H,4-5H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | AZQJUEMBUNXJKU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|