C12H17Cl2N3O2 — CID 114127211
2,6-dichloro-N-[2-[2-(dimethylamino)ethoxy]ethyl]pyridine-3-carboxamide (PubChem CID 114127211) has the molecular formula C12H17Cl2N3O2 and a molecular weight of 306.19 g/mol. Its IUPAC name is 2,6-dichloro-N-[2-[2-(dimethylamino)ethoxy]ethyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-[2-[2-(dimethylamino)ethoxy]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114127211 |
| Molecular Formula | C12H17Cl2N3O2 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2,6-dichloro-N-[2-[2-(dimethylamino)ethoxy]ethyl]pyridine-3-carboxamide |
| SMILES | CN(C)CCOCCNC(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C12H17Cl2N3O2/c1-17(2)6-8-19-7-5-15-12(18)9-3-4-10(13)16-11(9)14/h3-4H,5-8H2,1-2H3,(H,15,18) |
| InChIKey | WRCSOIDUFJRNAC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|