C13H17Cl2N3O2 — CID 106993258
2,6-dichloro-N-[3-(diethylamino)-3-oxopropyl]pyridine-3-carboxamide (PubChem CID 106993258) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is 2,6-dichloro-N-[3-(diethylamino)-3-oxopropyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-[3-(diethylamino)-3-oxopropyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 106993258 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2,6-dichloro-N-[3-(diethylamino)-3-oxopropyl]pyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)CCNC(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C13H17Cl2N3O2/c1-3-18(4-2)11(19)7-8-16-13(20)9-5-6-10(14)17-12(9)15/h5-6H,3-4,7-8H2,1-2H3,(H,16,20) |
| InChIKey | NQEJPQJSLCTILM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|