C10H11Cl2N3O3 — CID 155072068
2-[(2,6-dichloropyridine-3-carbonyl)amino]ethyl N-methylcarbamate (PubChem CID 155072068) has the molecular formula C10H11Cl2N3O3 and a molecular weight of 292.12 g/mol. Its IUPAC name is 2-[(2,6-dichloropyridine-3-carbonyl)amino]ethyl N-methylcarbamate.
| Compound Name | 2-[(2,6-dichloropyridine-3-carbonyl)amino]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 155072068 |
| Molecular Formula | C10H11Cl2N3O3 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 2-[(2,6-dichloropyridine-3-carbonyl)amino]ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCNC(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O3/c1-13-10(17)18-5-4-14-9(16)6-2-3-7(11)15-8(6)12/h2-3H,4-5H2,1H3,(H,13,17)(H,14,16) |
| InChIKey | XFVYNVMVGQYEGI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|