C11H17ClN2O3 — CID 106812685
2-chloro-N-[2-[2-(dimethylamino)ethoxy]ethyl]furan-3-carboxamide (PubChem CID 106812685) has the molecular formula C11H17ClN2O3 and a molecular weight of 260.72 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-(dimethylamino)ethoxy]ethyl]furan-3-carboxamide.
| Compound Name | 2-chloro-N-[2-[2-(dimethylamino)ethoxy]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106812685 |
| Molecular Formula | C11H17ClN2O3 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-chloro-N-[2-[2-(dimethylamino)ethoxy]ethyl]furan-3-carboxamide |
| SMILES | CN(C)CCOCCNC(=O)c1ccoc1Cl |
| InChI | InChI=1S/C11H17ClN2O3/c1-14(2)5-8-16-7-4-13-11(15)9-3-6-17-10(9)12/h3,6H,4-5,7-8H2,1-2H3,(H,13,15) |
| InChIKey | NXPPKGYYNUMSMA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|