C11H17ClN2O2 — CID 106685261
2-chloro-N-[2-(diethylamino)ethyl]furan-3-carboxamide (PubChem CID 106685261) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-chloro-N-[2-(diethylamino)ethyl]furan-3-carboxamide.
| Compound Name | 2-chloro-N-[2-(diethylamino)ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106685261 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-chloro-N-[2-(diethylamino)ethyl]furan-3-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1ccoc1Cl |
| InChI | InChI=1S/C11H17ClN2O2/c1-3-14(4-2)7-6-13-11(15)9-5-8-16-10(9)12/h5,8H,3-4,6-7H2,1-2H3,(H,13,15) |
| InChIKey | UIPQTKHKWIQFCJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |