C9H12ClNO3S — CID 106687268
2-chloro-N-(3-methylsulfinylpropyl)furan-3-carboxamide (PubChem CID 106687268) has the molecular formula C9H12ClNO3S and a molecular weight of 249.72 g/mol. Its IUPAC name is 2-chloro-N-(3-methylsulfinylpropyl)furan-3-carboxamide.
| Compound Name | 2-chloro-N-(3-methylsulfinylpropyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106687268 |
| Molecular Formula | C9H12ClNO3S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-chloro-N-(3-methylsulfinylpropyl)furan-3-carboxamide |
| SMILES | CS(=O)CCCNC(=O)c1ccoc1Cl |
| InChI | InChI=1S/C9H12ClNO3S/c1-15(13)6-2-4-11-9(12)7-3-5-14-8(7)10/h3,5H,2,4,6H2,1H3,(H,11,12) |
| InChIKey | VMPNVZJNXIMORY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|