C10H13FN2O2S — CID 115646493
3-fluoro-N-(3-methylsulfinylpropyl)pyridine-4-carboxamide (PubChem CID 115646493) has the molecular formula C10H13FN2O2S and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-fluoro-N-(3-methylsulfinylpropyl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-(3-methylsulfinylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115646493 |
| Molecular Formula | C10H13FN2O2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-fluoro-N-(3-methylsulfinylpropyl)pyridine-4-carboxamide |
| SMILES | CS(=O)CCCNC(=O)c1ccncc1F |
| InChI | InChI=1S/C10H13FN2O2S/c1-16(15)6-2-4-13-10(14)8-3-5-12-7-9(8)11/h3,5,7H,2,4,6H2,1H3,(H,13,14) |
| InChIKey | HSLPGDKIZWWYKK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|