C11H13BrFNO2S — CID 115679027
2-bromo-6-fluoro-N-(3-methylsulfinylpropyl)benzamide (PubChem CID 115679027) has the molecular formula C11H13BrFNO2S and a molecular weight of 322.20 g/mol. Its IUPAC name is 2-bromo-6-fluoro-N-(3-methylsulfinylpropyl)benzamide.
| Compound Name | 2-bromo-6-fluoro-N-(3-methylsulfinylpropyl)benzamide |
|---|---|
| PubChem CID | 115679027 |
| Molecular Formula | C11H13BrFNO2S |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 2-bromo-6-fluoro-N-(3-methylsulfinylpropyl)benzamide |
| SMILES | CS(=O)CCCNC(=O)c1c(F)cccc1Br |
| InChI | InChI=1S/C11H13BrFNO2S/c1-17(16)7-3-6-14-11(15)10-8(12)4-2-5-9(10)13/h2,4-5H,3,6-7H2,1H3,(H,14,15) |
| InChIKey | QCRBHGZMWSPJBK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|