C11H12BrF2NO2S — CID 97051469
4-bromo-2,6-difluoro-N-[3-[(R)-methylsulfinyl]propyl]benzamide (PubChem CID 97051469) has the molecular formula C11H12BrF2NO2S and a molecular weight of 340.19 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-[3-[(R)-methylsulfinyl]propyl]benzamide.
| Compound Name | 4-bromo-2,6-difluoro-N-[3-[(R)-methylsulfinyl]propyl]benzamide |
|---|---|
| PubChem CID | 97051469 |
| Molecular Formula | C11H12BrF2NO2S |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-[3-[(R)-methylsulfinyl]propyl]benzamide |
| SMILES | C[S@@](=O)CCCNC(=O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H12BrF2NO2S/c1-18(17)4-2-3-15-11(16)10-8(13)5-7(12)6-9(10)14/h5-6H,2-4H2,1H3,(H,15,16)/t18-/m1/s1 |
| InChIKey | PUSRJJYBWCNEOY-GOSISDBHSA-N |
| XLogP | 2.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|