C12H14BrF2NO2S — CID 115687743
4-bromo-2,6-difluoro-N-(4-methylsulfinylbutan-2-yl)benzamide (PubChem CID 115687743) has the molecular formula C12H14BrF2NO2S and a molecular weight of 354.22 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-(4-methylsulfinylbutan-2-yl)benzamide.
| Compound Name | 4-bromo-2,6-difluoro-N-(4-methylsulfinylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 115687743 |
| Molecular Formula | C12H14BrF2NO2S |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-(4-methylsulfinylbutan-2-yl)benzamide |
| SMILES | CC(CCS(C)=O)NC(=O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H14BrF2NO2S/c1-7(3-4-19(2)18)16-12(17)11-9(14)5-8(13)6-10(11)15/h5-7H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | HYYURVQULCRZQC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |