C11H8BrF2NO — CID 114389970
4-bromo-N-but-3-yn-2-yl-2,6-difluorobenzamide (PubChem CID 114389970) has the molecular formula C11H8BrF2NO and a molecular weight of 288.09 g/mol. Its IUPAC name is 4-bromo-N-but-3-yn-2-yl-2,6-difluorobenzamide.
| Compound Name | 4-bromo-N-but-3-yn-2-yl-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 114389970 |
| Molecular Formula | C11H8BrF2NO |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | 4-bromo-N-but-3-yn-2-yl-2,6-difluorobenzamide |
| SMILES | C#CC(C)NC(=O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H8BrF2NO/c1-3-6(2)15-11(16)10-8(13)4-7(12)5-9(10)14/h1,4-6H,2H3,(H,15,16) |
| InChIKey | XCUAKQQPSFXCQR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|