C12H14BrF2NOS — CID 75378516
4-bromo-2,6-difluoro-N-(4-methylsulfanylbutan-2-yl)benzamide (PubChem CID 75378516) has the molecular formula C12H14BrF2NOS and a molecular weight of 338.22 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-(4-methylsulfanylbutan-2-yl)benzamide.
| Compound Name | 4-bromo-2,6-difluoro-N-(4-methylsulfanylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 75378516 |
| Molecular Formula | C12H14BrF2NOS |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-(4-methylsulfanylbutan-2-yl)benzamide |
| SMILES | CSCCC(C)NC(=O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H14BrF2NOS/c1-7(3-4-18-2)16-12(17)11-9(14)5-8(13)6-10(11)15/h5-7H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | QJIKIPYCYYFGHW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |