C12H15BrFNOS — CID 115636187
2-bromo-5-fluoro-N-(4-methylsulfanylbutan-2-yl)benzamide (PubChem CID 115636187) has the molecular formula C12H15BrFNOS and a molecular weight of 320.23 g/mol. Its IUPAC name is 2-bromo-5-fluoro-N-(4-methylsulfanylbutan-2-yl)benzamide.
| Compound Name | 2-bromo-5-fluoro-N-(4-methylsulfanylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 115636187 |
| Molecular Formula | C12H15BrFNOS |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 2-bromo-5-fluoro-N-(4-methylsulfanylbutan-2-yl)benzamide |
| SMILES | CSCCC(C)NC(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C12H15BrFNOS/c1-8(5-6-17-2)15-12(16)10-7-9(14)3-4-11(10)13/h3-4,7-8H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | IWYUOIQDAZGXII-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |