C14H17Br2F2NO — CID 106356219
4-bromo-N-(1-bromo-4,4-dimethylpentan-3-yl)-2,6-difluorobenzamide (PubChem CID 106356219) has the molecular formula C14H17Br2F2NO and a molecular weight of 413.10 g/mol. Its IUPAC name is 4-bromo-N-(1-bromo-4,4-dimethylpentan-3-yl)-2,6-difluorobenzamide.
| Compound Name | 4-bromo-N-(1-bromo-4,4-dimethylpentan-3-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 106356219 |
| Molecular Formula | C14H17Br2F2NO |
| Molecular Weight | 413.10 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | 4-bromo-N-(1-bromo-4,4-dimethylpentan-3-yl)-2,6-difluorobenzamide |
| SMILES | CC(C)(C)C(CCBr)NC(=O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C14H17Br2F2NO/c1-14(2,3)11(4-5-15)19-13(20)12-9(17)6-8(16)7-10(12)18/h6-7,11H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | NCNUGSPBGACWJH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.10 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|