C15H21Br2NO2 — CID 106356212
4-bromo-N-(1-bromo-4,4-dimethylpentan-3-yl)-2-methoxybenzamide (PubChem CID 106356212) has the molecular formula C15H21Br2NO2 and a molecular weight of 407.15 g/mol. Its IUPAC name is 4-bromo-N-(1-bromo-4,4-dimethylpentan-3-yl)-2-methoxybenzamide.
| Compound Name | 4-bromo-N-(1-bromo-4,4-dimethylpentan-3-yl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 106356212 |
| Molecular Formula | C15H21Br2NO2 |
| Molecular Weight | 407.15 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | 4-bromo-N-(1-bromo-4,4-dimethylpentan-3-yl)-2-methoxybenzamide |
| SMILES | COc1cc(Br)ccc1C(=O)NC(CCBr)C(C)(C)C |
| InChI | InChI=1S/C15H21Br2NO2/c1-15(2,3)13(7-8-16)18-14(19)11-6-5-10(17)9-12(11)20-4/h5-6,9,13H,7-8H2,1-4H3,(H,18,19) |
| InChIKey | KUBRXUDHGHQJHC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.15 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|