C15H22BrNO3 — CID 106356090
N-(1-bromo-4,4-dimethylpentan-3-yl)-2-hydroxy-5-methoxybenzamide (PubChem CID 106356090) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is N-(1-bromo-4,4-dimethylpentan-3-yl)-2-hydroxy-5-methoxybenzamide.
| Compound Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-2-hydroxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 106356090 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-2-hydroxy-5-methoxybenzamide |
| SMILES | COc1ccc(O)c(C(=O)NC(CCBr)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H22BrNO3/c1-15(2,3)13(7-8-16)17-14(19)11-9-10(20-4)5-6-12(11)18/h5-6,9,13,18H,7-8H2,1-4H3,(H,17,19) |
| InChIKey | QLXLAAYUXWBQKI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|