C13H17NO5 — CID 95359062
(4S)-4-[(2-hydroxy-5-methoxybenzoyl)amino]pentanoic acid (PubChem CID 95359062) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is (4S)-4-[(2-hydroxy-5-methoxybenzoyl)amino]pentanoic acid.
| Compound Name | (4S)-4-[(2-hydroxy-5-methoxybenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 95359062 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (4S)-4-[(2-hydroxy-5-methoxybenzoyl)amino]pentanoic acid |
| SMILES | COc1ccc(O)c(C(=O)N[C@@H](C)CCC(=O)O)c1 |
| InChI | InChI=1S/C13H17NO5/c1-8(3-6-12(16)17)14-13(18)10-7-9(19-2)4-5-11(10)15/h4-5,7-8,15H,3,6H2,1-2H3,(H,14,18)(H,16,17)/t8-/m0/s1 |
| InChIKey | UANDQXDQUZFMKM-QMMMGPOBSA-N |
| XLogP | 1.38 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |