C11H12N2O3 — CID 55207961
N-(1-cyanoethyl)-2-hydroxy-5-methoxybenzamide (PubChem CID 55207961) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-(1-cyanoethyl)-2-hydroxy-5-methoxybenzamide.
| Compound Name | N-(1-cyanoethyl)-2-hydroxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 55207961 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-(1-cyanoethyl)-2-hydroxy-5-methoxybenzamide |
| SMILES | COc1ccc(O)c(C(=O)NC(C)C#N)c1 |
| InChI | InChI=1S/C11H12N2O3/c1-7(6-12)13-11(15)9-5-8(16-2)3-4-10(9)14/h3-5,7,14H,1-2H3,(H,13,15) |
| InChIKey | UQUHPIKUFKMRJQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |