C11H13BrClNO2S — CID 103842015
3-bromo-4-chloro-N-(3-methylsulfinylpropyl)benzamide (PubChem CID 103842015) has the molecular formula C11H13BrClNO2S and a molecular weight of 338.65 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-(3-methylsulfinylpropyl)benzamide.
| Compound Name | 3-bromo-4-chloro-N-(3-methylsulfinylpropyl)benzamide |
|---|---|
| PubChem CID | 103842015 |
| Molecular Formula | C11H13BrClNO2S |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | 3-bromo-4-chloro-N-(3-methylsulfinylpropyl)benzamide |
| SMILES | CS(=O)CCCNC(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C11H13BrClNO2S/c1-17(16)6-2-5-14-11(15)8-3-4-10(13)9(12)7-8/h3-4,7H,2,5-6H2,1H3,(H,14,15) |
| InChIKey | NQRFVRCWZNGCMF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|