C15H22BrClN2O — CID 103841799
3-bromo-4-chloro-N-[4-[methyl(propan-2-yl)amino]butyl]benzamide (PubChem CID 103841799) has the molecular formula C15H22BrClN2O and a molecular weight of 361.71 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[4-[methyl(propan-2-yl)amino]butyl]benzamide.
| Compound Name | 3-bromo-4-chloro-N-[4-[methyl(propan-2-yl)amino]butyl]benzamide |
|---|---|
| PubChem CID | 103841799 |
| Molecular Formula | C15H22BrClN2O |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 3-bromo-4-chloro-N-[4-[methyl(propan-2-yl)amino]butyl]benzamide |
| SMILES | CC(C)N(C)CCCCNC(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C15H22BrClN2O/c1-11(2)19(3)9-5-4-8-18-15(20)12-6-7-14(17)13(16)10-12/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,18,20) |
| InChIKey | CDOBBXIMTVZFRR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|