C11H15NO4S — CID 103895676
3,5-dihydroxy-N-(3-methylsulfinylpropyl)benzamide (PubChem CID 103895676) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 3,5-dihydroxy-N-(3-methylsulfinylpropyl)benzamide.
| Compound Name | 3,5-dihydroxy-N-(3-methylsulfinylpropyl)benzamide |
|---|---|
| PubChem CID | 103895676 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3,5-dihydroxy-N-(3-methylsulfinylpropyl)benzamide |
| SMILES | CS(=O)CCCNC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H15NO4S/c1-17(16)4-2-3-12-11(15)8-5-9(13)7-10(14)6-8/h5-7,13-14H,2-4H2,1H3,(H,12,15) |
| InChIKey | XIEBXRBMATYCHO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|