C13H18ClNO3 — CID 107847362
N-(6-chlorohexyl)-3,5-dihydroxybenzamide (PubChem CID 107847362) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is N-(6-chlorohexyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(6-chlorohexyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107847362 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-(6-chlorohexyl)-3,5-dihydroxybenzamide |
| SMILES | O=C(NCCCCCCCl)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C13H18ClNO3/c14-5-3-1-2-4-6-15-13(18)10-7-11(16)9-12(17)8-10/h7-9,16-17H,1-6H2,(H,15,18) |
| InChIKey | BYCXAQYKDAOGRP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|