C17H20N4O4 — CID 3309734
5-hydroxy-N-[5-[(5-hydroxypyridine-3-carbonyl)amino]pentyl]pyridine-3-carboxamide (PubChem CID 3309734) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 5-hydroxy-N-[5-[(5-hydroxypyridine-3-carbonyl)amino]pentyl]pyridine-3-carboxamide.
| Compound Name | 5-hydroxy-N-[5-[(5-hydroxypyridine-3-carbonyl)amino]pentyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3309734 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 5-hydroxy-N-[5-[(5-hydroxypyridine-3-carbonyl)amino]pentyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCCCNC(=O)c1cncc(O)c1)c1cncc(O)c1 |
| InChI | InChI=1S/C17H20N4O4/c22-14-6-12(8-18-10-14)16(24)20-4-2-1-3-5-21-17(25)13-7-15(23)11-19-9-13/h6-11,22-23H,1-5H2,(H,20,24)(H,21,25) |
| InChIKey | WIQXKZCGMVZITJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|