C12H19N3O3 — CID 143571890
N-(2-acetamidoethyl)-5-hydroxypyridine-3-carboxamide;ethane (PubChem CID 143571890) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-5-hydroxypyridine-3-carboxamide;ethane.
| Compound Name | N-(2-acetamidoethyl)-5-hydroxypyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143571890 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N-(2-acetamidoethyl)-5-hydroxypyridine-3-carboxamide;ethane |
| SMILES | CC.CC(=O)NCCNC(=O)c1cncc(O)c1 |
| InChI | InChI=1S/C10H13N3O3.C2H6/c1-7(14)12-2-3-13-10(16)8-4-9(15)6-11-5-8;1-2/h4-6,15H,2-3H2,1H3,(H,12,14)(H,13,16);1-2H3 |
| InChIKey | QBIPGFSLTBBMOD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|