C9H12N2O4S — CID 63866364
5-hydroxy-N-(2-methylsulfonylethyl)pyridine-3-carboxamide (PubChem CID 63866364) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is 5-hydroxy-N-(2-methylsulfonylethyl)pyridine-3-carboxamide.
| Compound Name | 5-hydroxy-N-(2-methylsulfonylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63866364 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-hydroxy-N-(2-methylsulfonylethyl)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)CCNC(=O)c1cncc(O)c1 |
| InChI | InChI=1S/C9H12N2O4S/c1-16(14,15)3-2-11-9(13)7-4-8(12)6-10-5-7/h4-6,12H,2-3H2,1H3,(H,11,13) |
| InChIKey | JNWCNECUVGPBRE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |