C10H14N2O3 — CID 63865493
5-hydroxy-N-(3-methoxypropyl)pyridine-3-carboxamide (PubChem CID 63865493) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 5-hydroxy-N-(3-methoxypropyl)pyridine-3-carboxamide.
| Compound Name | 5-hydroxy-N-(3-methoxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63865493 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 5-hydroxy-N-(3-methoxypropyl)pyridine-3-carboxamide |
| SMILES | COCCCNC(=O)c1cncc(O)c1 |
| InChI | InChI=1S/C10H14N2O3/c1-15-4-2-3-12-10(14)8-5-9(13)7-11-6-8/h5-7,13H,2-4H2,1H3,(H,12,14) |
| InChIKey | KKLHTVNXPSTYDP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|